C32H34N2O5 — CID 177361221
oxan-4-yl (4R,7R)-4-isoquinolin-5-yl-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,4a,6,7,8,8a-hexahydro-1H-quinoline-3-carboxylate (PubChem CID 177361221) has the molecular formula C32H34N2O5 and a molecular weight of 526.63 g/mol. Its IUPAC name is oxan-4-yl (4R,7R)-4-isoquinolin-5-yl-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,4a,6,7,8,8a-hexahydro-1H-quinoline-3-carboxylate.
| Compound Name | oxan-4-yl (4R,7R)-4-isoquinolin-5-yl-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,4a,6,7,8,8a-hexahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 177361221 |
| Molecular Formula | C32H34N2O5 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | oxan-4-yl (4R,7R)-4-isoquinolin-5-yl-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,4a,6,7,8,8a-hexahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccccc1[C@H]1CC(=O)C2C(C1)NC(C)=C(C(=O)OC1CCOCC1)[C@H]2c1cccc2cnccc12 |
| InChI | InChI=1S/C32H34N2O5/c1-19-29(32(36)39-22-11-14-38-15-12-22)30(25-8-5-6-20-18-33-13-10-23(20)25)31-26(34-19)16-21(17-27(31)35)24-7-3-4-9-28(24)37-2/h3-10,13,18,21-22,26,30-31,34H,11-12,14-17H2,1-2H3/t21-,26?,30-,31?/m1/s1 |
| InChIKey | AZOHXXGNGLSDAZ-SEEZXGLGSA-N |
| XLogP | 5.06 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |