C30H35N3O6 — CID 177361187
cyclohexyl 7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate;2-methyl-6-nitropyridine (PubChem CID 177361187) has the molecular formula C30H35N3O6 and a molecular weight of 533.63 g/mol. Its IUPAC name is cyclohexyl 7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate;2-methyl-6-nitropyridine.
| Compound Name | cyclohexyl 7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate;2-methyl-6-nitropyridine |
|---|---|
| PubChem CID | 177361187 |
| Molecular Formula | C30H35N3O6 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | cyclohexyl 7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate;2-methyl-6-nitropyridine |
| SMILES | COc1ccccc1C1CC(=O)C2=C(C1)NC(C)=C(C(=O)OC1CCCCC1)C2.Cc1cccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C24H29NO4.C6H6N2O2/c1-15-19(24(27)29-17-8-4-3-5-9-17)14-20-21(25-15)12-16(13-22(20)26)18-10-6-7-11-23(18)28-2;1-5-3-2-4-6(7-5)8(9)10/h6-7,10-11,16-17,25H,3-5,8-9,12-14H2,1-2H3;2-4H,1H3 |
| InChIKey | LCXRMQVXEQRTMJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|