C26H30N2O4 — CID 177361112
[(1S,5R,6R)-3-methyl-8-azatricyclo[3.2.1.03,8]octan-6-yl] (7R)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate (PubChem CID 177361112) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is [(1S,5R,6R)-3-methyl-8-azatricyclo[3.2.1.03,8]octan-6-yl] (7R)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate.
| Compound Name | [(1S,5R,6R)-3-methyl-8-azatricyclo[3.2.1.03,8]octan-6-yl] (7R)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
|---|---|
| PubChem CID | 177361112 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | [(1S,5R,6R)-3-methyl-8-azatricyclo[3.2.1.03,8]octan-6-yl] (7R)-7-(2-methoxyphenyl)-2-methyl-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxylate |
| SMILES | COc1ccccc1[C@H]1CC(=O)C2=C(C1)NC(C)=C(C(=O)O[C@@H]1C[C@@H]3CC4(C)C[C@H]1N34)C2 |
| InChI | InChI=1S/C26H30N2O4/c1-14-18(25(30)32-24-10-16-12-26(2)13-21(24)28(16)26)11-19-20(27-14)8-15(9-22(19)29)17-6-4-5-7-23(17)31-3/h4-7,15-16,21,24,27H,8-13H2,1-3H3/t15-,16-,21-,24-,26?/m1/s1 |
| InChIKey | IPYLPNXDZBIKOP-GVUZSNNKSA-N |
| XLogP | 3.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |