C35H40N2O4 — CID 177361295
ethane;[(2E)-2-methylpenta-2,4-dienyl] (4R,7R)-4-(1H-indol-4-yl)-7-(2-methoxyphenyl)-2,4-dimethyl-5-oxo-1,6,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 177361295) has the molecular formula C35H40N2O4 and a molecular weight of 552.72 g/mol. Its IUPAC name is ethane;[(2E)-2-methylpenta-2,4-dienyl] (4R,7R)-4-(1H-indol-4-yl)-7-(2-methoxyphenyl)-2,4-dimethyl-5-oxo-1,6,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | ethane;[(2E)-2-methylpenta-2,4-dienyl] (4R,7R)-4-(1H-indol-4-yl)-7-(2-methoxyphenyl)-2,4-dimethyl-5-oxo-1,6,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 177361295 |
| Molecular Formula | C35H40N2O4 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | ethane;[(2E)-2-methylpenta-2,4-dienyl] (4R,7R)-4-(1H-indol-4-yl)-7-(2-methoxyphenyl)-2,4-dimethyl-5-oxo-1,6,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | C=C/C=C(\C)COC(=O)C1=C(C)NC2=C(C(=O)C[C@H](c3ccccc3OC)C2)[C@@]1(C)c1cccc2[nH]ccc12.CC |
| InChI | InChI=1S/C33H34N2O4.C2H6/c1-6-10-20(2)19-39-32(37)30-21(3)35-27-17-22(23-11-7-8-14-29(23)38-5)18-28(36)31(27)33(30,4)25-12-9-13-26-24(25)15-16-34-26;1-2/h6-16,22,34-35H,1,17-19H2,2-5H3;1-2H3/b20-10+;/t22-,33+;/m1./s1 |
| InChIKey | IITDQBQIJRXKKS-TVDOSNOHSA-N |
| XLogP | 7.41 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|