C31H29N3O5 — CID 177361316
1,3-oxazol-2-ylmethyl (7R)-4-(1H-indol-4-yl)-7-(2-methoxyphenyl)-2,4-dimethyl-5-oxo-1,6,7,8-tetrahydroquinoline-3-carboxylate (PubChem CID 177361316) has the molecular formula C31H29N3O5 and a molecular weight of 523.59 g/mol. Its IUPAC name is 1,3-oxazol-2-ylmethyl (7R)-4-(1H-indol-4-yl)-7-(2-methoxyphenyl)-2,4-dimethyl-5-oxo-1,6,7,8-tetrahydroquinoline-3-carboxylate.
| Compound Name | 1,3-oxazol-2-ylmethyl (7R)-4-(1H-indol-4-yl)-7-(2-methoxyphenyl)-2,4-dimethyl-5-oxo-1,6,7,8-tetrahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 177361316 |
| Molecular Formula | C31H29N3O5 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 1,3-oxazol-2-ylmethyl (7R)-4-(1H-indol-4-yl)-7-(2-methoxyphenyl)-2,4-dimethyl-5-oxo-1,6,7,8-tetrahydroquinoline-3-carboxylate |
| SMILES | COc1ccccc1[C@H]1CC(=O)C2=C(C1)NC(C)=C(C(=O)OCc1ncco1)C2(C)c1cccc2[nH]ccc12 |
| InChI | InChI=1S/C31H29N3O5/c1-18-28(30(36)39-17-27-33-13-14-38-27)31(2,22-8-6-9-23-21(22)11-12-32-23)29-24(34-18)15-19(16-25(29)35)20-7-4-5-10-26(20)37-3/h4-14,19,32,34H,15-17H2,1-3H3/t19-,31?/m1/s1 |
| InChIKey | MBYJGTUCMTYZLC-MFUYNUFSSA-N |
| XLogP | 5.44 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |