C14H23NO — CID 177362181
6-methyl-5-[(2Z,4E)-3-methylocta-2,4-dien-2-yl]-3,4-dihydro-2H-1,4-oxazine (PubChem CID 177362181) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 6-methyl-5-[(2Z,4E)-3-methylocta-2,4-dien-2-yl]-3,4-dihydro-2H-1,4-oxazine.
| Compound Name | 6-methyl-5-[(2Z,4E)-3-methylocta-2,4-dien-2-yl]-3,4-dihydro-2H-1,4-oxazine |
|---|---|
| PubChem CID | 177362181 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 6-methyl-5-[(2Z,4E)-3-methylocta-2,4-dien-2-yl]-3,4-dihydro-2H-1,4-oxazine |
| SMILES | CCC/C=C/C(C)=C(/C)C1=C(C)OCCN1 |
| InChI | InChI=1S/C14H23NO/c1-5-6-7-8-11(2)12(3)14-13(4)16-10-9-15-14/h7-8,15H,5-6,9-10H2,1-4H3/b8-7+,12-11- |
| InChIKey | SWCUDMZZSGUVOB-MDFXNHGISA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|