C40H40FN5O4 — CID 177362508
1-[1-[4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]azetidin-3-yl]-4-[2-(2-fluoro-4-nitrophenyl)ethyl]piperazine (PubChem CID 177362508) has the molecular formula C40H40FN5O4 and a molecular weight of 673.79 g/mol. Its IUPAC name is 1-[1-[4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]azetidin-3-yl]-4-[2-(2-fluoro-4-nitrophenyl)ethyl]piperazine.
| Compound Name | 1-[1-[4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]azetidin-3-yl]-4-[2-(2-fluoro-4-nitrophenyl)ethyl]piperazine |
|---|---|
| PubChem CID | 177362508 |
| Molecular Formula | C40H40FN5O4 |
| Molecular Weight | 673.79 g/mol |
| Exact Mass | 673.31 |
| IUPAC Name | 1-[1-[4-[2,6-bis(phenylmethoxy)-3-pyridinyl]phenyl]azetidin-3-yl]-4-[2-(2-fluoro-4-nitrophenyl)ethyl]piperazine |
| SMILES | O=[N+]([O-])c1ccc(CCN2CCN(C3CN(c4ccc(-c5ccc(OCc6ccccc6)nc5OCc5ccccc5)cc4)C3)CC2)c(F)c1 |
| InChI | InChI=1S/C40H40FN5O4/c41-38-25-35(46(47)48)16-13-33(38)19-20-43-21-23-44(24-22-43)36-26-45(27-36)34-14-11-32(12-15-34)37-17-18-39(49-28-30-7-3-1-4-8-30)42-40(37)50-29-31-9-5-2-6-10-31/h1-18,25,36H,19-24,26-29H2 |
| InChIKey | XBBGLOBKXLYIHJ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 84.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.79 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|