C18H20FN3 — CID 177364506
N-[3-fluoro-4-(2-methylprop-2-enyl)phenyl]-5,6,7,8-tetrahydro-2,6-naphthyridin-3-amine (PubChem CID 177364506) has the molecular formula C18H20FN3 and a molecular weight of 297.38 g/mol. Its IUPAC name is N-[3-fluoro-4-(2-methylprop-2-enyl)phenyl]-5,6,7,8-tetrahydro-2,6-naphthyridin-3-amine.
| Compound Name | N-[3-fluoro-4-(2-methylprop-2-enyl)phenyl]-5,6,7,8-tetrahydro-2,6-naphthyridin-3-amine |
|---|---|
| PubChem CID | 177364506 |
| Molecular Formula | C18H20FN3 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-[3-fluoro-4-(2-methylprop-2-enyl)phenyl]-5,6,7,8-tetrahydro-2,6-naphthyridin-3-amine |
| SMILES | C=C(C)Cc1ccc(Nc2cc3c(cn2)CCNC3)cc1F |
| InChI | InChI=1S/C18H20FN3/c1-12(2)7-13-3-4-16(9-17(13)19)22-18-8-15-10-20-6-5-14(15)11-21-18/h3-4,8-9,11,20H,1,5-7,10H2,2H3,(H,21,22) |
| InChIKey | JZPGEXITUGKZCY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|