C19H15BrN2O — CID 177366777
6-(1-bromoethyl)-8-methyl-4-pyridin-3-yl-[1]benzofuro[3,2-b]pyridine (PubChem CID 177366777) has the molecular formula C19H15BrN2O and a molecular weight of 367.25 g/mol. Its IUPAC name is 6-(1-bromoethyl)-8-methyl-4-pyridin-3-yl-[1]benzofuro[3,2-b]pyridine.
| Compound Name | 6-(1-bromoethyl)-8-methyl-4-pyridin-3-yl-[1]benzofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 177366777 |
| Molecular Formula | C19H15BrN2O |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 6-(1-bromoethyl)-8-methyl-4-pyridin-3-yl-[1]benzofuro[3,2-b]pyridine |
| SMILES | Cc1cc(C(C)Br)c2oc3c(-c4cccnc4)ccnc3c2c1 |
| InChI | InChI=1S/C19H15BrN2O/c1-11-8-15(12(2)20)18-16(9-11)17-19(23-18)14(5-7-22-17)13-4-3-6-21-10-13/h3-10,12H,1-2H3 |
| InChIKey | GRERCKURHZMHEY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|