C22H23N3O2S — CID 169268993
(Z)-3-amino-N-[1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]but-2-enethioamide (PubChem CID 169268993) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is (Z)-3-amino-N-[1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]but-2-enethioamide.
| Compound Name | (Z)-3-amino-N-[1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]but-2-enethioamide |
|---|---|
| PubChem CID | 169268993 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | (Z)-3-amino-N-[1-(3,6-dimethyl-4-oxo-2-pyridin-3-ylchromen-8-yl)ethyl]but-2-enethioamide |
| SMILES | C/C(N)=C/C(=S)NC(C)c1cc(C)cc2c(=O)c(C)c(-c3cccnc3)oc12 |
| InChI | InChI=1S/C22H23N3O2S/c1-12-8-17(15(4)25-19(28)10-13(2)23)22-18(9-12)20(26)14(3)21(27-22)16-6-5-7-24-11-16/h5-11,15H,23H2,1-4H3,(H,25,28)/b13-10- |
| InChIKey | YZSOTURLFUWMSA-RAXLEYEMSA-N |
| XLogP | 4.31 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|