C18H17N3O4 — CID 174204740
1-(3,6-dimethyl-4-oxo-2-pyrazin-2-ylchromen-8-yl)ethylcarbamic acid (PubChem CID 174204740) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1-(3,6-dimethyl-4-oxo-2-pyrazin-2-ylchromen-8-yl)ethylcarbamic acid.
| Compound Name | 1-(3,6-dimethyl-4-oxo-2-pyrazin-2-ylchromen-8-yl)ethylcarbamic acid |
|---|---|
| PubChem CID | 174204740 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 1-(3,6-dimethyl-4-oxo-2-pyrazin-2-ylchromen-8-yl)ethylcarbamic acid |
| SMILES | Cc1cc(C(C)NC(=O)O)c2oc(-c3cnccn3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C18H17N3O4/c1-9-6-12(11(3)21-18(23)24)17-13(7-9)15(22)10(2)16(25-17)14-8-19-4-5-20-14/h4-8,11,21H,1-3H3,(H,23,24) |
| InChIKey | FPXDZRPOGCNNJI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |