C17H17N3O2 — CID 169268963
8-[(1R)-1-aminoethyl]-3,6-dimethyl-2-pyrimidin-5-ylchromen-4-one (PubChem CID 169268963) has the molecular formula C17H17N3O2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 8-[(1R)-1-aminoethyl]-3,6-dimethyl-2-pyrimidin-5-ylchromen-4-one.
| Compound Name | 8-[(1R)-1-aminoethyl]-3,6-dimethyl-2-pyrimidin-5-ylchromen-4-one |
|---|---|
| PubChem CID | 169268963 |
| Molecular Formula | C17H17N3O2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 8-[(1R)-1-aminoethyl]-3,6-dimethyl-2-pyrimidin-5-ylchromen-4-one |
| SMILES | Cc1cc([C@@H](C)N)c2oc(-c3cncnc3)c(C)c(=O)c2c1 |
| InChI | InChI=1S/C17H17N3O2/c1-9-4-13(11(3)18)17-14(5-9)15(21)10(2)16(22-17)12-6-19-8-20-7-12/h4-8,11H,18H2,1-3H3/t11-/m1/s1 |
| InChIKey | LFHIISSEQOXNBA-LLVKDONJSA-N |
| XLogP | 2.89 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |