About 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine
6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine (PubChem CID 177368065) has the molecular formula C14H23F3N2
and a molecular weight of 276.35 g/mol. Its IUPAC name is 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine.
Molecular Properties
| Compound Name | 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine |
| PubChem CID | 177368065 |
| Molecular Formula | C14H23F3N2 |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine |
| SMILES | CCCN.CCc1ccc(C(F)(F)F)c(C(C)C)n1 |
| InChI | InChI=1S/C11H14F3N.C3H9N/c1-4-8-5-6-9(11(12,13)14)10(15-8)7(2)3;1-2-3-4/h5-7H,4H2,1-3H3;2-4H2,1H3 |
| InChIKey | SRBILZOAAZEFTM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine?
The IUPAC name of 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine (CID 177368065) is 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine.
What is the SMILES notation for 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine?
The canonical SMILES for 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine is CCCN.CCc1ccc(C(F)(F)F)c(C(C)C)n1.
What is the InChIKey of 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine?
The InChIKey is SRBILZOAAZEFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N.C3H9N/c1-4-8-5-6-9(11(12,13)14)10(15-8)7(2)3;1-2-3-4/h5-7H,4H2,1-3H3;2-4H2,1H3.
What are the key properties of 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine?
6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine has a molecular weight of 276.35 g/mol, XLogP of 4.14, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-propan-2-yl-3-(trifluoromethyl)pyridine;propan-1-amine is sourced from PubChem (CID 177368065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).