C28H48ClN3O5 — CID 177368234
N-(3-chloro-4-methylcyclohexyl)-8-[2-[(3,4-dimethylcyclohexyl)methylamino]-2-oxoethyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide (PubChem CID 177368234) has the molecular formula C28H48ClN3O5 and a molecular weight of 542.16 g/mol. Its IUPAC name is N-(3-chloro-4-methylcyclohexyl)-8-[2-[(3,4-dimethylcyclohexyl)methylamino]-2-oxoethyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide.
| Compound Name | N-(3-chloro-4-methylcyclohexyl)-8-[2-[(3,4-dimethylcyclohexyl)methylamino]-2-oxoethyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
|---|---|
| PubChem CID | 177368234 |
| Molecular Formula | C28H48ClN3O5 |
| Molecular Weight | 542.16 g/mol |
| Exact Mass | 541.33 |
| IUPAC Name | N-(3-chloro-4-methylcyclohexyl)-8-[2-[(3,4-dimethylcyclohexyl)methylamino]-2-oxoethyl]-3-hydroxy-3,4,6,6a,8,9,10,10a-octahydro-2H-pyrano[2,3-c][1,5]oxazocine-1-carboxamide |
| SMILES | CC1CCC(CNC(=O)CC2CCC3C(COCC(O)CN3C(=O)NC3CCC(C)C(Cl)C3)O2)CC1C |
| InChI | InChI=1S/C28H48ClN3O5/c1-17-4-6-20(10-19(17)3)13-30-27(34)12-23-8-9-25-26(37-23)16-36-15-22(33)14-32(25)28(35)31-21-7-5-18(2)24(29)11-21/h17-26,33H,4-16H2,1-3H3,(H,30,34)(H,31,35) |
| InChIKey | NSHFNSYWEKJYHK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.16 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|