C16H20INO4 — CID 177368518
2-O-tert-butyl 4-O-methyl 7-iodo-3,4-dihydro-1H-isoquinoline-2,4-dicarboxylate (PubChem CID 177368518) has the molecular formula C16H20INO4 and a molecular weight of 417.24 g/mol. Its IUPAC name is 2-O-tert-butyl 4-O-methyl 7-iodo-3,4-dihydro-1H-isoquinoline-2,4-dicarboxylate.
| Compound Name | 2-O-tert-butyl 4-O-methyl 7-iodo-3,4-dihydro-1H-isoquinoline-2,4-dicarboxylate |
|---|---|
| PubChem CID | 177368518 |
| Molecular Formula | C16H20INO4 |
| Molecular Weight | 417.24 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | 2-O-tert-butyl 4-O-methyl 7-iodo-3,4-dihydro-1H-isoquinoline-2,4-dicarboxylate |
| SMILES | COC(=O)C1CN(C(=O)OC(C)(C)C)Cc2cc(I)ccc21 |
| InChI | InChI=1S/C16H20INO4/c1-16(2,3)22-15(20)18-8-10-7-11(17)5-6-12(10)13(9-18)14(19)21-4/h5-7,13H,8-9H2,1-4H3 |
| InChIKey | OQGZZNNGECGOST-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|