C14H22N2O5 — CID 86680441
2-O-tert-butyl 7-O-methyl 8-oxo-1,3,4,6,7,8a-hexahydropyrrolo[1,2-a]pyrazine-2,7-dicarboxylate (PubChem CID 86680441) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-O-tert-butyl 7-O-methyl 8-oxo-1,3,4,6,7,8a-hexahydropyrrolo[1,2-a]pyrazine-2,7-dicarboxylate.
| Compound Name | 2-O-tert-butyl 7-O-methyl 8-oxo-1,3,4,6,7,8a-hexahydropyrrolo[1,2-a]pyrazine-2,7-dicarboxylate |
|---|---|
| PubChem CID | 86680441 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-O-tert-butyl 7-O-methyl 8-oxo-1,3,4,6,7,8a-hexahydropyrrolo[1,2-a]pyrazine-2,7-dicarboxylate |
| SMILES | COC(=O)C1CN2CCN(C(=O)OC(C)(C)C)CC2C1=O |
| InChI | InChI=1S/C14H22N2O5/c1-14(2,3)21-13(19)16-6-5-15-7-9(12(18)20-4)11(17)10(15)8-16/h9-10H,5-8H2,1-4H3 |
| InChIKey | DIOJCEWFGYXDJR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|