C27H39N5O2 — CID 177368772
N-[(2S)-3-[[[(1S)-1-amino-1-methyl-2,3-dihydroinden-5-yl]amino]methoxy]-1,1-dicyclopropylpropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide (PubChem CID 177368772) has the molecular formula C27H39N5O2 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-[(2S)-3-[[[(1S)-1-amino-1-methyl-2,3-dihydroinden-5-yl]amino]methoxy]-1,1-dicyclopropylpropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | N-[(2S)-3-[[[(1S)-1-amino-1-methyl-2,3-dihydroinden-5-yl]amino]methoxy]-1,1-dicyclopropylpropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 177368772 |
| Molecular Formula | C27H39N5O2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | N-[(2S)-3-[[[(1S)-1-amino-1-methyl-2,3-dihydroinden-5-yl]amino]methoxy]-1,1-dicyclopropylpropan-2-yl]-2-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)n1nccc1C(=O)N[C@H](COCNc1ccc2c(c1)CC[C@]2(C)N)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C27H39N5O2/c1-17(2)32-24(11-13-30-32)26(33)31-23(25(18-4-5-18)19-6-7-19)15-34-16-29-21-8-9-22-20(14-21)10-12-27(22,3)28/h8-9,11,13-14,17-19,23,25,29H,4-7,10,12,15-16,28H2,1-3H3,(H,31,33)/t23-,27+/m1/s1 |
| InChIKey | BETANNKEGJBEAV-KCWPFWIISA-N |
| XLogP | 4.20 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|