C27H26B3F5N8O — CID 177369055
CID 177369055 (PubChem CID 177369055) has the molecular formula C27H26B3F5N8O and a molecular weight of 605.99 g/mol.
| Compound Name | CID 177369055 |
|---|---|
| PubChem CID | 177369055 |
| Molecular Formula | C27H26B3F5N8O |
| Molecular Weight | 605.99 g/mol |
| Exact Mass | 606.24 |
| IUPAC Name | — |
| SMILES | C1CC1.FC(F)F.[B]C([B])([B])n1nc(-c2cccc3c(N4CCN(C(=O)C(C)(C#N)C(F)F)C(C)C4)ncnc23)cc1C#N |
| InChI | InChI=1S/C23H19B3F2N8O.C3H6.CHF3/c1-13-10-34(6-7-35(13)21(37)22(2,11-30)20(27)28)19-16-5-3-4-15(18(16)31-12-32-19)17-8-14(9-29)36(33-17)23(24,25)26;1-2-3-1;2-1(3)4/h3-5,8,12-13,20H,6-7,10H2,1-2H3;1-3H2;1H |
| InChIKey | MTVJOMXOJKJFHA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 114.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.99 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|