C30H26B3F2N9O — CID 177369105
CID 177369105 (PubChem CID 177369105) has the molecular formula C30H26B3F2N9O and a molecular weight of 599.03 g/mol.
| Compound Name | CID 177369105 |
|---|---|
| PubChem CID | 177369105 |
| Molecular Formula | C30H26B3F2N9O |
| Molecular Weight | 599.03 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | — |
| SMILES | C1CC1.[B]C([B])([B])n1nc(-c2ccc(-c3cncc(F)c3)c3c(N4CCN(C(=O)C(C#N)CF)C(C)C4)ncnc23)cc1C#N |
| InChI | InChI=1S/C27H20B3F2N9O.C3H6/c1-15-13-39(4-5-40(15)26(42)17(8-31)9-33)25-23-20(16-6-18(32)12-35-11-16)2-3-21(24(23)36-14-37-25)22-7-19(10-34)41(38-22)27(28,29)30;1-2-3-1/h2-3,6-7,11-12,14-15,17H,4-5,8,13H2,1H3;1-3H2 |
| InChIKey | YWXANIRHSCSGCR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 127.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.03 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|