C20H20Cl2N2O4 — CID 177371450
(4S)-5-(benzylamino)-4-[[2-(2,4-dichlorophenyl)acetyl]amino]-5-oxopentanoic acid (PubChem CID 177371450) has the molecular formula C20H20Cl2N2O4 and a molecular weight of 423.30 g/mol. Its IUPAC name is (4S)-5-(benzylamino)-4-[[2-(2,4-dichlorophenyl)acetyl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-5-(benzylamino)-4-[[2-(2,4-dichlorophenyl)acetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 177371450 |
| Molecular Formula | C20H20Cl2N2O4 |
| Molecular Weight | 423.30 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (4S)-5-(benzylamino)-4-[[2-(2,4-dichlorophenyl)acetyl]amino]-5-oxopentanoic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)Cc1ccc(Cl)cc1Cl)C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H20Cl2N2O4/c21-15-7-6-14(16(22)11-15)10-18(25)24-17(8-9-19(26)27)20(28)23-12-13-4-2-1-3-5-13/h1-7,11,17H,8-10,12H2,(H,23,28)(H,24,25)(H,26,27)/t17-/m0/s1 |
| InChIKey | QXOUWADLQOKBPM-KRWDZBQOSA-N |
| XLogP | 3.20 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |