C19H22N6O3 — CID 177372085
4-[4-[4-[(4-amino-5-methyl-2-oxopyrimidin-1-yl)methyl]triazol-1-yl]butyl]benzoic acid (PubChem CID 177372085) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 4-[4-[4-[(4-amino-5-methyl-2-oxopyrimidin-1-yl)methyl]triazol-1-yl]butyl]benzoic acid.
| Compound Name | 4-[4-[4-[(4-amino-5-methyl-2-oxopyrimidin-1-yl)methyl]triazol-1-yl]butyl]benzoic acid |
|---|---|
| PubChem CID | 177372085 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4-[4-[4-[(4-amino-5-methyl-2-oxopyrimidin-1-yl)methyl]triazol-1-yl]butyl]benzoic acid |
| SMILES | Cc1cn(Cc2cn(CCCCc3ccc(C(=O)O)cc3)nn2)c(=O)nc1N |
| InChI | InChI=1S/C19H22N6O3/c1-13-10-24(19(28)21-17(13)20)11-16-12-25(23-22-16)9-3-2-4-14-5-7-15(8-6-14)18(26)27/h5-8,10,12H,2-4,9,11H2,1H3,(H,26,27)(H2,20,21,28) |
| InChIKey | BESDVXOCSMOARP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|