C19H20N8O2 — CID 177372086
4-[4-[4-[(6-aminopurin-9-yl)methyl]triazol-1-yl]butyl]benzoic acid (PubChem CID 177372086) has the molecular formula C19H20N8O2 and a molecular weight of 392.42 g/mol. Its IUPAC name is 4-[4-[4-[(6-aminopurin-9-yl)methyl]triazol-1-yl]butyl]benzoic acid.
| Compound Name | 4-[4-[4-[(6-aminopurin-9-yl)methyl]triazol-1-yl]butyl]benzoic acid |
|---|---|
| PubChem CID | 177372086 |
| Molecular Formula | C19H20N8O2 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 4-[4-[4-[(6-aminopurin-9-yl)methyl]triazol-1-yl]butyl]benzoic acid |
| SMILES | Nc1ncnc2c1ncn2Cc1cn(CCCCc2ccc(C(=O)O)cc2)nn1 |
| InChI | InChI=1S/C19H20N8O2/c20-17-16-18(22-11-21-17)26(12-23-16)9-15-10-27(25-24-15)8-2-1-3-13-4-6-14(7-5-13)19(28)29/h4-7,10-12H,1-3,8-9H2,(H,28,29)(H2,20,21,22) |
| InChIKey | MZFOHJPLJMRSRQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 137.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|