C11H15N8O4P — CID 57408545
[3-[4-[(6-aminopurin-9-yl)methyl]triazol-1-yl]-2-hydroxypropyl]phosphonic acid (PubChem CID 57408545) has the molecular formula C11H15N8O4P and a molecular weight of 354.27 g/mol. Its IUPAC name is [3-[4-[(6-aminopurin-9-yl)methyl]triazol-1-yl]-2-hydroxypropyl]phosphonic acid.
| Compound Name | [3-[4-[(6-aminopurin-9-yl)methyl]triazol-1-yl]-2-hydroxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 57408545 |
| Molecular Formula | C11H15N8O4P |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [3-[4-[(6-aminopurin-9-yl)methyl]triazol-1-yl]-2-hydroxypropyl]phosphonic acid |
| SMILES | Nc1ncnc2c1ncn2Cc1cn(CC(O)CP(=O)(O)O)nn1 |
| InChI | InChI=1S/C11H15N8O4P/c12-10-9-11(14-5-13-10)18(6-15-9)1-7-2-19(17-16-7)3-8(20)4-24(21,22)23/h2,5-6,8,20H,1,3-4H2,(H2,12,13,14)(H2,21,22,23) |
| InChIKey | FOLFEWJJTTXDDJ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 178.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|