C17H17FN8 — CID 167910593
9-[[1-[(1R)-1-(4-fluorophenyl)propyl]triazol-4-yl]methyl]purin-6-amine (PubChem CID 167910593) has the molecular formula C17H17FN8 and a molecular weight of 352.38 g/mol. Its IUPAC name is 9-[[1-[(1R)-1-(4-fluorophenyl)propyl]triazol-4-yl]methyl]purin-6-amine.
| Compound Name | 9-[[1-[(1R)-1-(4-fluorophenyl)propyl]triazol-4-yl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 167910593 |
| Molecular Formula | C17H17FN8 |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 9-[[1-[(1R)-1-(4-fluorophenyl)propyl]triazol-4-yl]methyl]purin-6-amine |
| SMILES | CC[C@H](c1ccc(F)cc1)n1cc(Cn2cnc3c(N)ncnc32)nn1 |
| InChI | InChI=1S/C17H17FN8/c1-2-14(11-3-5-12(18)6-4-11)26-8-13(23-24-26)7-25-10-22-15-16(19)20-9-21-17(15)25/h3-6,8-10,14H,2,7H2,1H3,(H2,19,20,21)/t14-/m1/s1 |
| InChIKey | UQFCNYPEZGFGLO-CQSZACIVSA-N |
| XLogP | 2.19 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |