C13H9F2N5O — CID 62024049
2-(6-aminopurin-9-yl)-1-(2,5-difluorophenyl)ethanone (PubChem CID 62024049) has the molecular formula C13H9F2N5O and a molecular weight of 289.25 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-1-(2,5-difluorophenyl)ethanone.
| Compound Name | 2-(6-aminopurin-9-yl)-1-(2,5-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 62024049 |
| Molecular Formula | C13H9F2N5O |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-1-(2,5-difluorophenyl)ethanone |
| SMILES | Nc1ncnc2c1ncn2CC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H9F2N5O/c14-7-1-2-9(15)8(3-7)10(21)4-20-6-19-11-12(16)17-5-18-13(11)20/h1-3,5-6H,4H2,(H2,16,17,18) |
| InChIKey | HEPYBWOGAQGFTA-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |