C32H36N7+ — CID 57398747
9-[[4-[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]butyl]phenyl]methyl]purin-6-amine (PubChem CID 57398747) has the molecular formula C32H36N7+ and a molecular weight of 518.69 g/mol. Its IUPAC name is 9-[[4-[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]butyl]phenyl]methyl]purin-6-amine.
| Compound Name | 9-[[4-[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]butyl]phenyl]methyl]purin-6-amine |
|---|---|
| PubChem CID | 57398747 |
| Molecular Formula | C32H36N7+ |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 9-[[4-[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]butyl]phenyl]methyl]purin-6-amine |
| SMILES | Nc1ncnc2c1ncn2Cc1ccc(CCCCc2ccc(C[n+]3ccc(N4CCCC4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H36N7/c33-31-30-32(35-23-34-31)39(24-36-30)22-28-13-9-26(10-14-28)6-2-1-5-25-7-11-27(12-8-25)21-37-19-15-29(16-20-37)38-17-3-4-18-38/h7-16,19-20,23-24H,1-6,17-18,21-22H2,(H2,33,34,35)/q+1 |
| InChIKey | ADYKGDUPKYCDGJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|