C38H48Br2N4 — CID 10078582
1-[1-[[4-[2-[4-[[4-(azepan-1-yl)pyridin-1-ium-1-yl]methyl]phenyl]ethyl]phenyl]methyl]pyridin-1-ium-4-yl]azepane dibromide (PubChem CID 10078582) has the molecular formula C38H48Br2N4 and a molecular weight of 720.64 g/mol. Its IUPAC name is 1-[1-[[4-[2-[4-[[4-(azepan-1-yl)pyridin-1-ium-1-yl]methyl]phenyl]ethyl]phenyl]methyl]pyridin-1-ium-4-yl]azepane dibromide.
| Compound Name | 1-[1-[[4-[2-[4-[[4-(azepan-1-yl)pyridin-1-ium-1-yl]methyl]phenyl]ethyl]phenyl]methyl]pyridin-1-ium-4-yl]azepane dibromide |
|---|---|
| PubChem CID | 10078582 |
| Molecular Formula | C38H48Br2N4 |
| Molecular Weight | 720.64 g/mol |
| Exact Mass | 718.22 |
| IUPAC Name | 1-[1-[[4-[2-[4-[[4-(azepan-1-yl)pyridin-1-ium-1-yl]methyl]phenyl]ethyl]phenyl]methyl]pyridin-1-ium-4-yl]azepane dibromide |
| SMILES | [Br-].[Br-].c1cc(C[n+]2ccc(N3CCCCCC3)cc2)ccc1CCc1ccc(C[n+]2ccc(N3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C38H48N4.2BrH/c1-2-6-24-41(23-5-1)37-19-27-39(28-20-37)31-35-15-11-33(12-16-35)9-10-34-13-17-36(18-14-34)32-40-29-21-38(22-30-40)42-25-7-3-4-8-26-42;;/h11-22,27-30H,1-10,23-26,31-32H2;2*1H/q+2;;/p-2 |
| InChIKey | ZECXCOPYERGQMQ-UHFFFAOYSA-L |
| XLogP | 0.91 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.64 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|