C33H38BrN3O — CID 72696083
3-[[4-[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]butyl]phenyl]methylamino]phenol bromide (PubChem CID 72696083) has the molecular formula C33H38BrN3O and a molecular weight of 572.59 g/mol. Its IUPAC name is 3-[[4-[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]butyl]phenyl]methylamino]phenol bromide.
| Compound Name | 3-[[4-[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]butyl]phenyl]methylamino]phenol bromide |
|---|---|
| PubChem CID | 72696083 |
| Molecular Formula | C33H38BrN3O |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 571.22 |
| IUPAC Name | 3-[[4-[4-[4-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]butyl]phenyl]methylamino]phenol bromide |
| SMILES | Oc1cccc(NCc2ccc(CCCCc3ccc(C[n+]4ccc(N5CCCC5)cc4)cc3)cc2)c1.[Br-] |
| InChI | InChI=1S/C33H37N3O.BrH/c37-33-9-5-8-31(24-33)34-25-29-14-10-27(11-15-29)6-1-2-7-28-12-16-30(17-13-28)26-35-22-18-32(19-23-35)36-20-3-4-21-36;/h5,8-19,22-24,34H,1-4,6-7,20-21,25-26H2;1H |
| InChIKey | JBIINIIMCWDYGS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|