C34H40Br2N4 — CID 11158130
4-piperidin-1-yl-1-[[4-[4-[(4-piperidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium dibromide (PubChem CID 11158130) has the molecular formula C34H40Br2N4 and a molecular weight of 664.53 g/mol. Its IUPAC name is 4-piperidin-1-yl-1-[[4-[4-[(4-piperidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium dibromide.
| Compound Name | 4-piperidin-1-yl-1-[[4-[4-[(4-piperidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium dibromide |
|---|---|
| PubChem CID | 11158130 |
| Molecular Formula | C34H40Br2N4 |
| Molecular Weight | 664.53 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | 4-piperidin-1-yl-1-[[4-[4-[(4-piperidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium dibromide |
| SMILES | [Br-].[Br-].c1cc(-c2ccc(C[n+]3ccc(N4CCCCC4)cc3)cc2)ccc1C[n+]1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C34H40N4.2BrH/c1-3-19-37(20-4-1)33-15-23-35(24-16-33)27-29-7-11-31(12-8-29)32-13-9-30(10-14-32)28-36-25-17-34(18-26-36)38-21-5-2-6-22-38;;/h7-18,23-26H,1-6,19-22,27-28H2;2*1H/q+2;;/p-2 |
| InChIKey | COPHMLPTMRNPRB-UHFFFAOYSA-L |
| XLogP | 0.01 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.53 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|