C15H25N2+ — CID 66636932
1-(2,2-dimethylpropyl)-4-piperidin-1-ylpyridin-1-ium (PubChem CID 66636932) has the molecular formula C15H25N2+ and a molecular weight of 233.38 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-4-piperidin-1-ylpyridin-1-ium.
| Compound Name | 1-(2,2-dimethylpropyl)-4-piperidin-1-ylpyridin-1-ium |
|---|---|
| PubChem CID | 66636932 |
| Molecular Formula | C15H25N2+ |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-4-piperidin-1-ylpyridin-1-ium |
| SMILES | CC(C)(C)C[n+]1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C15H25N2/c1-15(2,3)13-16-11-7-14(8-12-16)17-9-5-4-6-10-17/h7-8,11-12H,4-6,9-10,13H2,1-3H3/q+1 |
| InChIKey | PICIBCGCRXMGPJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|