C32H36Br2N4 — CID 11331136
4-pyrrolidin-1-yl-1-[[3-[3-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium dibromide (PubChem CID 11331136) has the molecular formula C32H36Br2N4 and a molecular weight of 636.48 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-1-[[3-[3-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium dibromide.
| Compound Name | 4-pyrrolidin-1-yl-1-[[3-[3-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium dibromide |
|---|---|
| PubChem CID | 11331136 |
| Molecular Formula | C32H36Br2N4 |
| Molecular Weight | 636.48 g/mol |
| Exact Mass | 634.13 |
| IUPAC Name | 4-pyrrolidin-1-yl-1-[[3-[3-[(4-pyrrolidin-1-ylpyridin-1-ium-1-yl)methyl]phenyl]phenyl]methyl]pyridin-1-ium dibromide |
| SMILES | [Br-].[Br-].c1cc(C[n+]2ccc(N3CCCC3)cc2)cc(-c2cccc(C[n+]3ccc(N4CCCC4)cc3)c2)c1 |
| InChI | InChI=1S/C32H36N4.2BrH/c1-2-16-35(15-1)31-11-19-33(20-12-31)25-27-7-5-9-29(23-27)30-10-6-8-28(24-30)26-34-21-13-32(14-22-34)36-17-3-4-18-36;;/h5-14,19-24H,1-4,15-18,25-26H2;2*1H/q+2;;/p-2 |
| InChIKey | AVSVIYAWNUUMNJ-UHFFFAOYSA-L |
| XLogP | -0.77 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.48 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|