C16H12BrN3O3 — CID 177374451
3-(4-bromophenyl)-N-(2,5-dihydroxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 177374451) has the molecular formula C16H12BrN3O3 and a molecular weight of 374.19 g/mol. Its IUPAC name is 3-(4-bromophenyl)-N-(2,5-dihydroxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-bromophenyl)-N-(2,5-dihydroxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 177374451 |
| Molecular Formula | C16H12BrN3O3 |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 3-(4-bromophenyl)-N-(2,5-dihydroxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1cc(O)ccc1O)c1cc(-c2ccc(Br)cc2)n[nH]1 |
| InChI | InChI=1S/C16H12BrN3O3/c17-10-3-1-9(2-4-10)12-8-14(20-19-12)16(23)18-13-7-11(21)5-6-15(13)22/h1-8,21-22H,(H,18,23)(H,19,20) |
| InChIKey | ZFBIQHNINCPQPT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|