C23H17ClF5N9O2S — CID 177375214
6-[[5-chloro-2-(2,2-difluoroethylamino)-1,3-benzothiazol-6-yl]amino]-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 177375214) has the molecular formula C23H17ClF5N9O2S and a molecular weight of 613.96 g/mol. Its IUPAC name is 6-[[5-chloro-2-(2,2-difluoroethylamino)-1,3-benzothiazol-6-yl]amino]-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[[5-chloro-2-(2,2-difluoroethylamino)-1,3-benzothiazol-6-yl]amino]-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 177375214 |
| Molecular Formula | C23H17ClF5N9O2S |
| Molecular Weight | 613.96 g/mol |
| Exact Mass | 613.08 |
| IUPAC Name | 6-[[5-chloro-2-(2,2-difluoroethylamino)-1,3-benzothiazol-6-yl]amino]-3-[(1-methyl-1,2,4-triazol-3-yl)methyl]-1-[(3,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | Cn1cnc(Cn2c(=O)nc(Nc3cc4sc(NCC(F)F)nc4cc3Cl)n(Cc3cc(F)c(F)c(F)c3)c2=O)n1 |
| InChI | InChI=1S/C23H17ClF5N9O2S/c1-36-9-31-18(35-36)8-38-22(39)34-20(37(23(38)40)7-10-2-12(25)19(29)13(26)3-10)32-14-5-16-15(4-11(14)24)33-21(41-16)30-6-17(27)28/h2-5,9,17H,6-8H2,1H3,(H,30,33)(H,32,34,39) |
| InChIKey | ONUHFYYKTFGYTA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.96 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|