C26H24N6OSe — CID 177375718
3-[1-[[3-[5-[2-(dimethylamino)ethylselanyl]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile (PubChem CID 177375718) has the molecular formula C26H24N6OSe and a molecular weight of 515.48 g/mol. Its IUPAC name is 3-[1-[[3-[5-[2-(dimethylamino)ethylselanyl]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile.
| Compound Name | 3-[1-[[3-[5-[2-(dimethylamino)ethylselanyl]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 177375718 |
| Molecular Formula | C26H24N6OSe |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | 3-[1-[[3-[5-[2-(dimethylamino)ethylselanyl]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
| SMILES | CN(C)CC[Se]c1cnc(-c2cccc(Cn3nc(-c4cccc(C#N)c4)ccc3=O)c2)nc1 |
| InChI | InChI=1S/C26H24N6OSe/c1-31(2)11-12-34-23-16-28-26(29-17-23)22-8-4-6-20(14-22)18-32-25(33)10-9-24(30-32)21-7-3-5-19(13-21)15-27/h3-10,13-14,16-17H,11-12,18H2,1-2H3 |
| InChIKey | GIDGFVITTWSOCO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|