C30H30N6OSe — CID 177375720
3-[6-oxo-1-[[3-[5-(3-piperidin-1-ylpropylselanyl)pyrimidin-2-yl]phenyl]methyl]pyridazin-3-yl]benzonitrile (PubChem CID 177375720) has the molecular formula C30H30N6OSe and a molecular weight of 569.57 g/mol. Its IUPAC name is 3-[6-oxo-1-[[3-[5-(3-piperidin-1-ylpropylselanyl)pyrimidin-2-yl]phenyl]methyl]pyridazin-3-yl]benzonitrile.
| Compound Name | 3-[6-oxo-1-[[3-[5-(3-piperidin-1-ylpropylselanyl)pyrimidin-2-yl]phenyl]methyl]pyridazin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 177375720 |
| Molecular Formula | C30H30N6OSe |
| Molecular Weight | 569.57 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | 3-[6-oxo-1-[[3-[5-(3-piperidin-1-ylpropylselanyl)pyrimidin-2-yl]phenyl]methyl]pyridazin-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(=O)n(Cc3cccc(-c4ncc([Se]CCCN5CCCCC5)cn4)c3)n2)c1 |
| InChI | InChI=1S/C30H30N6OSe/c31-19-23-7-4-9-25(17-23)28-11-12-29(37)36(34-28)22-24-8-5-10-26(18-24)30-32-20-27(21-33-30)38-16-6-15-35-13-2-1-3-14-35/h4-5,7-12,17-18,20-21H,1-3,6,13-16,22H2 |
| InChIKey | XUMNDEDJVWYXQE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|