C27H26N6OSe — CID 177375719
3-[1-[[3-[5-[3-(dimethylamino)propylselanyl]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile (PubChem CID 177375719) has the molecular formula C27H26N6OSe and a molecular weight of 529.51 g/mol. Its IUPAC name is 3-[1-[[3-[5-[3-(dimethylamino)propylselanyl]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile.
| Compound Name | 3-[1-[[3-[5-[3-(dimethylamino)propylselanyl]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 177375719 |
| Molecular Formula | C27H26N6OSe |
| Molecular Weight | 529.51 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 3-[1-[[3-[5-[3-(dimethylamino)propylselanyl]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
| SMILES | CN(C)CCC[Se]c1cnc(-c2cccc(Cn3nc(-c4cccc(C#N)c4)ccc3=O)c2)nc1 |
| InChI | InChI=1S/C27H26N6OSe/c1-32(2)12-5-13-35-24-17-29-27(30-18-24)23-9-4-7-21(15-23)19-33-26(34)11-10-25(31-33)22-8-3-6-20(14-22)16-28/h3-4,6-11,14-15,17-18H,5,12-13,19H2,1-2H3 |
| InChIKey | OLFDNCRQUIKEDM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|