About ethyl (2-phenylbutanoylamino) carbonate
ethyl (2-phenylbutanoylamino) carbonate (PubChem CID 177376021) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is ethyl (2-phenylbutanoylamino) carbonate.
Molecular Properties
| Compound Name | ethyl (2-phenylbutanoylamino) carbonate |
| PubChem CID | 177376021 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | ethyl (2-phenylbutanoylamino) carbonate |
| SMILES | CCOC(=O)ONC(=O)C(CC)c1ccccc1 |
| InChI | InChI=1S/C13H17NO4/c1-3-11(10-8-6-5-7-9-10)12(15)14-18-13(16)17-4-2/h5-9,11H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | IKDZCKKDZRIFSZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2-phenylbutanoylamino) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2-phenylbutanoylamino) carbonate?
The IUPAC name of ethyl (2-phenylbutanoylamino) carbonate (CID 177376021) is ethyl (2-phenylbutanoylamino) carbonate.
What is the SMILES notation for ethyl (2-phenylbutanoylamino) carbonate?
The canonical SMILES for ethyl (2-phenylbutanoylamino) carbonate is CCOC(=O)ONC(=O)C(CC)c1ccccc1.
What is the InChIKey of ethyl (2-phenylbutanoylamino) carbonate?
The InChIKey is IKDZCKKDZRIFSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-3-11(10-8-6-5-7-9-10)12(15)14-18-13(16)17-4-2/h5-9,11H,3-4H2,1-2H3,(H,14,15).
What are the key properties of ethyl (2-phenylbutanoylamino) carbonate?
ethyl (2-phenylbutanoylamino) carbonate has a molecular weight of 251.28 g/mol, XLogP of 2.38, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2-phenylbutanoylamino) carbonate is sourced from PubChem (CID 177376021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).