C27H44O5S — CID 177376311
[(2S,6R)-6-[(5S,10S,13R,14R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptyl] hydrogen sulfate (PubChem CID 177376311) has the molecular formula C27H44O5S and a molecular weight of 480.71 g/mol. Its IUPAC name is [(2S,6R)-6-[(5S,10S,13R,14R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptyl] hydrogen sulfate.
| Compound Name | [(2S,6R)-6-[(5S,10S,13R,14R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptyl] hydrogen sulfate |
|---|---|
| PubChem CID | 177376311 |
| Molecular Formula | C27H44O5S |
| Molecular Weight | 480.71 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | [(2S,6R)-6-[(5S,10S,13R,14R,17R)-10,13-dimethyl-3-oxo-1,2,4,5,6,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-methylheptyl] hydrogen sulfate |
| SMILES | C[C@@H](CCC[C@@H](C)[C@H]1CC[C@H]2C3=CC[C@H]4CC(=O)CC[C@]4(C)C3CC[C@]12C)COS(=O)(=O)O |
| InChI | InChI=1S/C27H44O5S/c1-18(17-32-33(29,30)31)6-5-7-19(2)23-10-11-24-22-9-8-20-16-21(28)12-14-26(20,3)25(22)13-15-27(23,24)4/h9,18-20,23-25H,5-8,10-17H2,1-4H3,(H,29,30,31)/t18-,19+,20-,23+,24-,25?,26-,27+/m0/s1 |
| InChIKey | JYSXWROCTYGDAO-HBNASBQXSA-N |
| XLogP | 6.40 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|