C11H18O9 — CID 177377807
(3R,4S,5S)-3,4,5-trihydroxy-2-methylheptane-1,1,7-tricarboxylic acid (PubChem CID 177377807) has the molecular formula C11H18O9 and a molecular weight of 294.26 g/mol. Its IUPAC name is (3R,4S,5S)-3,4,5-trihydroxy-2-methylheptane-1,1,7-tricarboxylic acid.
| Compound Name | (3R,4S,5S)-3,4,5-trihydroxy-2-methylheptane-1,1,7-tricarboxylic acid |
|---|---|
| PubChem CID | 177377807 |
| Molecular Formula | C11H18O9 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (3R,4S,5S)-3,4,5-trihydroxy-2-methylheptane-1,1,7-tricarboxylic acid |
| SMILES | CC(C(C(=O)O)C(=O)O)[C@@H](O)[C@@H](O)[C@@H](O)CCC(=O)O |
| InChI | InChI=1S/C11H18O9/c1-4(7(10(17)18)11(19)20)8(15)9(16)5(12)2-3-6(13)14/h4-5,7-9,12,15-16H,2-3H2,1H3,(H,13,14)(H,17,18)(H,19,20)/t4?,5-,8+,9-/m0/s1 |
| InChIKey | BEXXQFMWRRURIQ-LQGWVIRLSA-N |
| XLogP | -1.64 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|