C33H44N4O4 — CID 177378458
methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexanoate (PubChem CID 177378458) has the molecular formula C33H44N4O4 and a molecular weight of 560.74 g/mol. Its IUPAC name is methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexanoate.
| Compound Name | methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexanoate |
|---|---|
| PubChem CID | 177378458 |
| Molecular Formula | C33H44N4O4 |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | methyl (2S)-6-(phenylmethoxycarbonylamino)-2-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentylamino]hexanoate |
| SMILES | COC(=O)[C@H](CCCCNC(=O)OCc1ccccc1)NCCCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C33H44N4O4/c1-40-32(38)30(20-10-13-23-36-33(39)41-24-25-14-4-2-5-15-25)34-21-11-3-12-22-35-31-26-16-6-8-18-28(26)37-29-19-9-7-17-27(29)31/h2,4-6,8,14-16,18,30,34H,3,7,9-13,17,19-24H2,1H3,(H,35,37)(H,36,39)/t30-/m0/s1 |
| InChIKey | RDIKQPPCBLVPNF-PMERELPUSA-N |
| XLogP | 5.92 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|