About (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate
(5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate (PubChem CID 177378862) has the molecular formula C17H11ClN2O2
and a molecular weight of 310.74 g/mol. Its IUPAC name is (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate.
Molecular Properties
| Compound Name | (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate |
| PubChem CID | 177378862 |
| Molecular Formula | C17H11ClN2O2 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate |
| SMILES | O=C(Oc1cncc(Cl)c1)c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C17H11ClN2O2/c18-15-8-16(11-20-10-15)22-17(21)13-5-3-12(4-6-13)14-2-1-7-19-9-14/h1-11H |
| InChIKey | ZYYDDFYJLRUJMT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate?
The IUPAC name of (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate (CID 177378862) is (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate.
What is the SMILES notation for (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate?
The canonical SMILES for (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate is O=C(Oc1cncc(Cl)c1)c1ccc(-c2cccnc2)cc1.
What is the InChIKey of (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate?
The InChIKey is ZYYDDFYJLRUJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClN2O2/c18-15-8-16(11-20-10-15)22-17(21)13-5-3-12(4-6-13)14-2-1-7-19-9-14/h1-11H.
What are the key properties of (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate?
(5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate has a molecular weight of 310.74 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-3-pyridinyl) 4-pyridin-3-ylbenzoate is sourced from PubChem (CID 177378862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).