C27H22N2O5 — CID 177382055
5-[(E)-3-[4-[(4-phenylmethoxyphenyl)methoxy]phenyl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 177382055) has the molecular formula C27H22N2O5 and a molecular weight of 454.48 g/mol. Its IUPAC name is 5-[(E)-3-[4-[(4-phenylmethoxyphenyl)methoxy]phenyl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-[4-[(4-phenylmethoxyphenyl)methoxy]phenyl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 177382055 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 5-[(E)-3-[4-[(4-phenylmethoxyphenyl)methoxy]phenyl]prop-2-enylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(=C/C=C/c2ccc(OCc3ccc(OCc4ccccc4)cc3)cc2)C(=O)N1 |
| InChI | InChI=1S/C27H22N2O5/c30-25-24(26(31)29-27(32)28-25)8-4-7-19-9-13-22(14-10-19)34-18-21-11-15-23(16-12-21)33-17-20-5-2-1-3-6-20/h1-16H,17-18H2,(H2,28,29,30,31,32)/b7-4+ |
| InChIKey | HIDNMPKQHJGNGJ-QPJJXVBHSA-N |
| XLogP | 4.15 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|