C20H21ClN2O3 — CID 177382626
phenyl N-[1-[(4-chlorophenyl)carbamoyl]cyclohexyl]carbamate (PubChem CID 177382626) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is phenyl N-[1-[(4-chlorophenyl)carbamoyl]cyclohexyl]carbamate.
| Compound Name | phenyl N-[1-[(4-chlorophenyl)carbamoyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 177382626 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | phenyl N-[1-[(4-chlorophenyl)carbamoyl]cyclohexyl]carbamate |
| SMILES | O=C(NC1(C(=O)Nc2ccc(Cl)cc2)CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C20H21ClN2O3/c21-15-9-11-16(12-10-15)22-18(24)20(13-5-2-6-14-20)23-19(25)26-17-7-3-1-4-8-17/h1,3-4,7-12H,2,5-6,13-14H2,(H,22,24)(H,23,25) |
| InChIKey | CWPJUPCOMWMTBP-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |