C18H20N2O3S — CID 177382618
phenyl N-[1-(thiophen-3-ylcarbamoyl)cyclohexyl]carbamate (PubChem CID 177382618) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is phenyl N-[1-(thiophen-3-ylcarbamoyl)cyclohexyl]carbamate.
| Compound Name | phenyl N-[1-(thiophen-3-ylcarbamoyl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 177382618 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | phenyl N-[1-(thiophen-3-ylcarbamoyl)cyclohexyl]carbamate |
| SMILES | O=C(NC1(C(=O)Nc2ccsc2)CCCCC1)Oc1ccccc1 |
| InChI | InChI=1S/C18H20N2O3S/c21-16(19-14-9-12-24-13-14)18(10-5-2-6-11-18)20-17(22)23-15-7-3-1-4-8-15/h1,3-4,7-9,12-13H,2,5-6,10-11H2,(H,19,21)(H,20,22) |
| InChIKey | IOPATSCQJHWEDB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |