C21H24O6 — CID 177382808
2-hydroxy-2-[2-[4-(3-propoxyphenyl)phenyl]ethyl]butanedioic acid (PubChem CID 177382808) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-hydroxy-2-[2-[4-(3-propoxyphenyl)phenyl]ethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-[4-(3-propoxyphenyl)phenyl]ethyl]butanedioic acid |
|---|---|
| PubChem CID | 177382808 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-hydroxy-2-[2-[4-(3-propoxyphenyl)phenyl]ethyl]butanedioic acid |
| SMILES | CCCOc1cccc(-c2ccc(CCC(O)(CC(=O)O)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C21H24O6/c1-2-12-27-18-5-3-4-17(13-18)16-8-6-15(7-9-16)10-11-21(26,20(24)25)14-19(22)23/h3-9,13,26H,2,10-12,14H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | QFFCGHXRYTYHKP-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |