C22H20Cl2N4O3 — CID 177383034
2-(1,3-benzodioxol-5-ylmethylamino)-6-[(3,4-dichlorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 177383034) has the molecular formula C22H20Cl2N4O3 and a molecular weight of 459.33 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-6-[(3,4-dichlorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-6-[(3,4-dichlorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 177383034 |
| Molecular Formula | C22H20Cl2N4O3 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-6-[(3,4-dichlorophenyl)methyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(NCc2ccc3c(c2)OCO3)nc2c1CN(Cc1ccc(Cl)c(Cl)c1)CC2 |
| InChI | InChI=1S/C22H20Cl2N4O3/c23-16-3-1-14(7-17(16)24)10-28-6-5-18-15(11-28)21(29)27-22(26-18)25-9-13-2-4-19-20(8-13)31-12-30-19/h1-4,7-8H,5-6,9-12H2,(H2,25,26,27,29) |
| InChIKey | KNKBVBUBPOZDIS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |