C18H31N2Sb — CID 177386245
CID 177386245 (PubChem CID 177386245) has the molecular formula C18H31N2Sb and a molecular weight of 397.22 g/mol.
| Compound Name | CID 177386245 |
|---|---|
| PubChem CID | 177386245 |
| Molecular Formula | C18H31N2Sb |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | — |
| SMILES | CC(NC(C)(C)C)c1cccc(C(C)NC(C)(C)C)c1[Sb] |
| InChI | InChI=1S/C18H31N2.Sb/c1-13(19-17(3,4)5)15-10-9-11-16(12-15)14(2)20-18(6,7)8;/h9-11,13-14,19-20H,1-8H3; |
| InChIKey | GCDDPRIOQWYTES-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|