C20H29N — CID 43731152
2,4,4-trimethyl-N-(1-naphthalen-1-ylethyl)pentan-2-amine (PubChem CID 43731152) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 2,4,4-trimethyl-N-(1-naphthalen-1-ylethyl)pentan-2-amine.
| Compound Name | 2,4,4-trimethyl-N-(1-naphthalen-1-ylethyl)pentan-2-amine |
|---|---|
| PubChem CID | 43731152 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 2,4,4-trimethyl-N-(1-naphthalen-1-ylethyl)pentan-2-amine |
| SMILES | CC(NC(C)(C)CC(C)(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C20H29N/c1-15(21-20(5,6)14-19(2,3)4)17-13-9-11-16-10-7-8-12-18(16)17/h7-13,15,21H,14H2,1-6H3 |
| InChIKey | UNILZQXCYCBYRJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |