C23H19NO4 — CID 177386249
(E)-2-(N-hydroxy-4-methoxyanilino)-1,4-diphenylbut-2-ene-1,4-dione (PubChem CID 177386249) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is (E)-2-(N-hydroxy-4-methoxyanilino)-1,4-diphenylbut-2-ene-1,4-dione.
| Compound Name | (E)-2-(N-hydroxy-4-methoxyanilino)-1,4-diphenylbut-2-ene-1,4-dione |
|---|---|
| PubChem CID | 177386249 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (E)-2-(N-hydroxy-4-methoxyanilino)-1,4-diphenylbut-2-ene-1,4-dione |
| SMILES | COc1ccc(N(O)/C(=C/C(=O)c2ccccc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO4/c1-28-20-14-12-19(13-15-20)24(27)21(23(26)18-10-6-3-7-11-18)16-22(25)17-8-4-2-5-9-17/h2-16,27H,1H3/b21-16+ |
| InChIKey | DFUYVPPGZQZFML-LTGZKZEYSA-N |
| XLogP | 4.54 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|