C29H23NO2 — CID 6063122
(Z)-2-(N-methyl-4-phenylanilino)-1,4-diphenylbut-2-ene-1,4-dione (PubChem CID 6063122) has the molecular formula C29H23NO2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (Z)-2-(N-methyl-4-phenylanilino)-1,4-diphenylbut-2-ene-1,4-dione.
| Compound Name | (Z)-2-(N-methyl-4-phenylanilino)-1,4-diphenylbut-2-ene-1,4-dione |
|---|---|
| PubChem CID | 6063122 |
| Molecular Formula | C29H23NO2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (Z)-2-(N-methyl-4-phenylanilino)-1,4-diphenylbut-2-ene-1,4-dione |
| SMILES | CN(/C(=C\C(=O)c1ccccc1)C(=O)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H23NO2/c1-30(26-19-17-23(18-20-26)22-11-5-2-6-12-22)27(29(32)25-15-9-4-10-16-25)21-28(31)24-13-7-3-8-14-24/h2-21H,1H3/b27-21- |
| InChIKey | PHCFCRAWEDDCOD-MEFGMAGPSA-N |
| XLogP | 6.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|